C21H15ClFN3O2S — CID 4629756
3-chloro-N-[4-[(4-fluorobenzoyl)carbamothioylamino]phenyl]benzamide (PubChem CID 4629756) has the molecular formula C21H15ClFN3O2S and a molecular weight of 427.89 g/mol. Its IUPAC name is 3-chloro-N-[4-[(4-fluorobenzoyl)carbamothioylamino]phenyl]benzamide.
| Compound Name | 3-chloro-N-[4-[(4-fluorobenzoyl)carbamothioylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 4629756 |
| Molecular Formula | C21H15ClFN3O2S |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 3-chloro-N-[4-[(4-fluorobenzoyl)carbamothioylamino]phenyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(NC(=O)c2cccc(Cl)c2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H15ClFN3O2S/c22-15-3-1-2-14(12-15)20(28)24-17-8-10-18(11-9-17)25-21(29)26-19(27)13-4-6-16(23)7-5-13/h1-12H,(H,24,28)(H2,25,26,27,29) |
| InChIKey | CHFLSGDPVMJCMB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|