C19H27N5O4S — CID 46298135
6-(dimethylsulfamoylamino)-2-(4-propylpiperazin-1-yl)quinoline-4-carboxylic acid (PubChem CID 46298135) has the molecular formula C19H27N5O4S and a molecular weight of 421.52 g/mol. Its IUPAC name is 6-(dimethylsulfamoylamino)-2-(4-propylpiperazin-1-yl)quinoline-4-carboxylic acid.
| Compound Name | 6-(dimethylsulfamoylamino)-2-(4-propylpiperazin-1-yl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 46298135 |
| Molecular Formula | C19H27N5O4S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 6-(dimethylsulfamoylamino)-2-(4-propylpiperazin-1-yl)quinoline-4-carboxylic acid |
| SMILES | CCCN1CCN(c2cc(C(=O)O)c3cc(NS(=O)(=O)N(C)C)ccc3n2)CC1 |
| InChI | InChI=1S/C19H27N5O4S/c1-4-7-23-8-10-24(11-9-23)18-13-16(19(25)26)15-12-14(5-6-17(15)20-18)21-29(27,28)22(2)3/h5-6,12-13,21H,4,7-11H2,1-3H3,(H,25,26) |
| InChIKey | GVLNUXUTZVQCEW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |