About N-pentan-2-ylpentanamide
N-pentan-2-ylpentanamide (PubChem CID 4629842) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is N-pentan-2-ylpentanamide.
Molecular Properties
| Compound Name | N-pentan-2-ylpentanamide |
| PubChem CID | 4629842 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | N-pentan-2-ylpentanamide |
| SMILES | CCCCC(=O)NC(C)CCC |
| InChI | InChI=1S/C10H21NO/c1-4-6-8-10(12)11-9(3)7-5-2/h9H,4-8H2,1-3H3,(H,11,12) |
| InChIKey | DJHSUFWTUGTEIJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-pentan-2-ylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pentan-2-ylpentanamide?
The IUPAC name of N-pentan-2-ylpentanamide (CID 4629842) is N-pentan-2-ylpentanamide.
What is the SMILES notation for N-pentan-2-ylpentanamide?
The canonical SMILES for N-pentan-2-ylpentanamide is CCCCC(=O)NC(C)CCC.
What is the InChIKey of N-pentan-2-ylpentanamide?
The InChIKey is DJHSUFWTUGTEIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO/c1-4-6-8-10(12)11-9(3)7-5-2/h9H,4-8H2,1-3H3,(H,11,12).
What are the key properties of N-pentan-2-ylpentanamide?
N-pentan-2-ylpentanamide has a molecular weight of 171.28 g/mol, XLogP of 2.48, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-pentan-2-ylpentanamide is sourced from PubChem (CID 4629842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).