C27H26N2O4 — CID 46298653
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2-phenylquinolin-4-yl)oxyacetamide (PubChem CID 46298653) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2-phenylquinolin-4-yl)oxyacetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2-phenylquinolin-4-yl)oxyacetamide |
|---|---|
| PubChem CID | 46298653 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2-phenylquinolin-4-yl)oxyacetamide |
| SMILES | COc1ccc(CCNC(=O)COc2cc(-c3ccccc3)nc3ccccc23)cc1OC |
| InChI | InChI=1S/C27H26N2O4/c1-31-24-13-12-19(16-26(24)32-2)14-15-28-27(30)18-33-25-17-23(20-8-4-3-5-9-20)29-22-11-7-6-10-21(22)25/h3-13,16-17H,14-15,18H2,1-2H3,(H,28,30) |
| InChIKey | WRVWRDFMRYZTSH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |