C25H27N5OS — CID 46298924
N-(4-phenylbutan-2-yl)-1-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperidine-4-carboxamide (PubChem CID 46298924) has the molecular formula C25H27N5OS and a molecular weight of 445.59 g/mol. Its IUPAC name is N-(4-phenylbutan-2-yl)-1-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperidine-4-carboxamide.
| Compound Name | N-(4-phenylbutan-2-yl)-1-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46298924 |
| Molecular Formula | C25H27N5OS |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | N-(4-phenylbutan-2-yl)-1-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperidine-4-carboxamide |
| SMILES | CC(CCc1ccccc1)NC(=O)C1CCN(c2ncnc3c2sc2ncccc23)CC1 |
| InChI | InChI=1S/C25H27N5OS/c1-17(9-10-18-6-3-2-4-7-18)29-24(31)19-11-14-30(15-12-19)23-22-21(27-16-28-23)20-8-5-13-26-25(20)32-22/h2-8,13,16-17,19H,9-12,14-15H2,1H3,(H,29,31) |
| InChIKey | QVDOWRYOYUUENC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |