C24H28N4O2S2 — CID 46299949
5-[2-piperidin-1-yl-2-(4-propan-2-ylphenyl)ethyl]-8,10-dithia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-triene-6,12-dione (PubChem CID 46299949) has the molecular formula C24H28N4O2S2 and a molecular weight of 468.65 g/mol. Its IUPAC name is 5-[2-piperidin-1-yl-2-(4-propan-2-ylphenyl)ethyl]-8,10-dithia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-triene-6,12-dione.
| Compound Name | 5-[2-piperidin-1-yl-2-(4-propan-2-ylphenyl)ethyl]-8,10-dithia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-triene-6,12-dione |
|---|---|
| PubChem CID | 46299949 |
| Molecular Formula | C24H28N4O2S2 |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 5-[2-piperidin-1-yl-2-(4-propan-2-ylphenyl)ethyl]-8,10-dithia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3-triene-6,12-dione |
| SMILES | CC(C)c1ccc(C(Cn2cnc3c4c(sc3c2=O)SCC(=O)N4)N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H28N4O2S2/c1-15(2)16-6-8-17(9-7-16)18(27-10-4-3-5-11-27)12-28-14-25-20-21-24(31-13-19(29)26-21)32-22(20)23(28)30/h6-9,14-15,18H,3-5,10-13H2,1-2H3,(H,26,29) |
| InChIKey | NBFFYZWUYAKIGL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |