C20H16ClN5OS2 — CID 46300729
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-(3-chloro-5-methyl-1-phenylpyrazol-4-yl)methylideneamino]acetamide (PubChem CID 46300729) has the molecular formula C20H16ClN5OS2 and a molecular weight of 441.97 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-(3-chloro-5-methyl-1-phenylpyrazol-4-yl)methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-(3-chloro-5-methyl-1-phenylpyrazol-4-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 46300729 |
| Molecular Formula | C20H16ClN5OS2 |
| Molecular Weight | 441.97 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-(3-chloro-5-methyl-1-phenylpyrazol-4-yl)methylideneamino]acetamide |
| SMILES | Cc1c(/C=N/NC(=O)CSc2nc3ccccc3s2)c(Cl)nn1-c1ccccc1 |
| InChI | InChI=1S/C20H16ClN5OS2/c1-13-15(19(21)25-26(13)14-7-3-2-4-8-14)11-22-24-18(27)12-28-20-23-16-9-5-6-10-17(16)29-20/h2-11H,12H2,1H3,(H,24,27)/b22-11+ |
| InChIKey | WZQFRWSXWZPQTM-SSDVNMTOSA-N |
| XLogP | 4.69 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.97 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|