About N,N-dibutyl-7-(3-chloro-4-methylphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine
N,N-dibutyl-7-(3-chloro-4-methylphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 4630144) has the molecular formula C27H31ClN4
and a molecular weight of 447.03 g/mol. Its IUPAC name is N,N-dibutyl-7-(3-chloro-4-methylphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N,N-dibutyl-7-(3-chloro-4-methylphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine |
| PubChem CID | 4630144 |
| Molecular Formula | C27H31ClN4 |
| Molecular Weight | 447.03 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | N,N-dibutyl-7-(3-chloro-4-methylphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCCCN(CCCC)c1ncnc2c1c(-c1ccccc1)cn2-c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C27H31ClN4/c1-4-6-15-31(16-7-5-2)26-25-23(21-11-9-8-10-12-21)18-32(27(25)30-19-29-26)22-14-13-20(3)24(28)17-22/h8-14,17-19H,4-7,15-16H2,1-3H3 |
| InChIKey | GNHBOSIJXVNEGT-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.03 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dibutyl-7-(3-chloro-4-methylphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutyl-7-(3-chloro-4-methylphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine?
The IUPAC name of N,N-dibutyl-7-(3-chloro-4-methylphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine (CID 4630144) is N,N-dibutyl-7-(3-chloro-4-methylphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N,N-dibutyl-7-(3-chloro-4-methylphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N,N-dibutyl-7-(3-chloro-4-methylphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine is CCCCN(CCCC)c1ncnc2c1c(-c1ccccc1)cn2-c1ccc(C)c(Cl)c1.
What is the InChIKey of N,N-dibutyl-7-(3-chloro-4-methylphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine?
The InChIKey is GNHBOSIJXVNEGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H31ClN4/c1-4-6-15-31(16-7-5-2)26-25-23(21-11-9-8-10-12-21)18-32(27(25)30-19-29-26)22-14-13-20(3)24(28)17-22/h8-14,17-19H,4-7,15-16H2,1-3H3.
What are the key properties of N,N-dibutyl-7-(3-chloro-4-methylphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine?
N,N-dibutyl-7-(3-chloro-4-methylphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine has a molecular weight of 447.03 g/mol, XLogP of 7.46, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutyl-7-(3-chloro-4-methylphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 4630144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).