C28H30O6 — CID 4630209
[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxo-6-propylchromen-7-yl] 3-cyclopentylpropanoate (PubChem CID 4630209) has the molecular formula C28H30O6 and a molecular weight of 462.54 g/mol. Its IUPAC name is [3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxo-6-propylchromen-7-yl] 3-cyclopentylpropanoate.
| Compound Name | [3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxo-6-propylchromen-7-yl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 4630209 |
| Molecular Formula | C28H30O6 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | [3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxo-6-propylchromen-7-yl] 3-cyclopentylpropanoate |
| SMILES | CCCc1cc2c(=O)c(-c3ccc4c(c3)OCCO4)coc2cc1OC(=O)CCC1CCCC1 |
| InChI | InChI=1S/C28H30O6/c1-2-5-20-14-21-25(16-24(20)34-27(29)11-8-18-6-3-4-7-18)33-17-22(28(21)30)19-9-10-23-26(15-19)32-13-12-31-23/h9-10,14-18H,2-8,11-13H2,1H3 |
| InChIKey | IWBBGJGKPDGQNZ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|