C30H24N4O4 — CID 46303079
N-(4-cyano-1-phenylpyrazol-5-yl)-2-[2-(4-methylphenyl)-4-oxochromen-3-yl]oxybutanamide (PubChem CID 46303079) has the molecular formula C30H24N4O4 and a molecular weight of 504.55 g/mol. Its IUPAC name is N-(4-cyano-1-phenylpyrazol-5-yl)-2-[2-(4-methylphenyl)-4-oxochromen-3-yl]oxybutanamide.
| Compound Name | N-(4-cyano-1-phenylpyrazol-5-yl)-2-[2-(4-methylphenyl)-4-oxochromen-3-yl]oxybutanamide |
|---|---|
| PubChem CID | 46303079 |
| Molecular Formula | C30H24N4O4 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | N-(4-cyano-1-phenylpyrazol-5-yl)-2-[2-(4-methylphenyl)-4-oxochromen-3-yl]oxybutanamide |
| SMILES | CCC(Oc1c(-c2ccc(C)cc2)oc2ccccc2c1=O)C(=O)Nc1c(C#N)cnn1-c1ccccc1 |
| InChI | InChI=1S/C30H24N4O4/c1-3-24(30(36)33-29-21(17-31)18-32-34(29)22-9-5-4-6-10-22)37-28-26(35)23-11-7-8-12-25(23)38-27(28)20-15-13-19(2)14-16-20/h4-16,18,24H,3H2,1-2H3,(H,33,36) |
| InChIKey | LNYOTFWLEBZLLF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |