About 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N,N-diethylpropanamide
2-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N,N-diethylpropanamide (PubChem CID 46304521) has the molecular formula C13H21N3O2
and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N,N-diethylpropanamide.
Molecular Properties
| Compound Name | 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N,N-diethylpropanamide |
| PubChem CID | 46304521 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)n1c(C)cc(C)nc1=O |
| InChI | InChI=1S/C13H21N3O2/c1-6-15(7-2)12(17)11(5)16-10(4)8-9(3)14-13(16)18/h8,11H,6-7H2,1-5H3 |
| InChIKey | ZGOGPTLDRMILAG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N,N-diethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N,N-diethylpropanamide?
The IUPAC name of 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N,N-diethylpropanamide (CID 46304521) is 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N,N-diethylpropanamide.
What is the SMILES notation for 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N,N-diethylpropanamide?
The canonical SMILES for 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N,N-diethylpropanamide is CCN(CC)C(=O)C(C)n1c(C)cc(C)nc1=O.
What is the InChIKey of 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N,N-diethylpropanamide?
The InChIKey is ZGOGPTLDRMILAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O2/c1-6-15(7-2)12(17)11(5)16-10(4)8-9(3)14-13(16)18/h8,11H,6-7H2,1-5H3.
What are the key properties of 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N,N-diethylpropanamide?
2-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N,N-diethylpropanamide has a molecular weight of 251.33 g/mol, XLogP of 1.29, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N,N-diethylpropanamide is sourced from PubChem (CID 46304521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).