C20H23ClN2O2 — CID 46308613
5-chloro-2-[(2,3-dimethylphenoxy)methyl]-1-(3-methoxypropyl)benzimidazole (PubChem CID 46308613) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is 5-chloro-2-[(2,3-dimethylphenoxy)methyl]-1-(3-methoxypropyl)benzimidazole.
| Compound Name | 5-chloro-2-[(2,3-dimethylphenoxy)methyl]-1-(3-methoxypropyl)benzimidazole |
|---|---|
| PubChem CID | 46308613 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 5-chloro-2-[(2,3-dimethylphenoxy)methyl]-1-(3-methoxypropyl)benzimidazole |
| SMILES | COCCCn1c(COc2cccc(C)c2C)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H23ClN2O2/c1-14-6-4-7-19(15(14)2)25-13-20-22-17-12-16(21)8-9-18(17)23(20)10-5-11-24-3/h4,6-9,12H,5,10-11,13H2,1-3H3 |
| InChIKey | MCCFHDHAYLYVKA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|