About 3-[5-chloro-2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N,N-diethylpropan-1-amine
3-[5-chloro-2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N,N-diethylpropan-1-amine (PubChem CID 46308855) has the molecular formula C23H30ClN3O2
and a molecular weight of 415.97 g/mol. Its IUPAC name is 3-[5-chloro-2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N,N-diethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[5-chloro-2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N,N-diethylpropan-1-amine |
| PubChem CID | 46308855 |
| Molecular Formula | C23H30ClN3O2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 3-[5-chloro-2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCn1c(Cc2ccc(OC)c(OC)c2)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C23H30ClN3O2/c1-5-26(6-2)12-7-13-27-20-10-9-18(24)16-19(20)25-23(27)15-17-8-11-21(28-3)22(14-17)29-4/h8-11,14,16H,5-7,12-13,15H2,1-4H3 |
| InChIKey | NQDNSDKJAZNMMO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[5-chloro-2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N,N-diethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-chloro-2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N,N-diethylpropan-1-amine?
The IUPAC name of 3-[5-chloro-2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N,N-diethylpropan-1-amine (CID 46308855) is 3-[5-chloro-2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N,N-diethylpropan-1-amine.
What is the SMILES notation for 3-[5-chloro-2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N,N-diethylpropan-1-amine?
The canonical SMILES for 3-[5-chloro-2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N,N-diethylpropan-1-amine is CCN(CC)CCCn1c(Cc2ccc(OC)c(OC)c2)nc2cc(Cl)ccc21.
What is the InChIKey of 3-[5-chloro-2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N,N-diethylpropan-1-amine?
The InChIKey is NQDNSDKJAZNMMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30ClN3O2/c1-5-26(6-2)12-7-13-27-20-10-9-18(24)16-19(20)25-23(27)15-17-8-11-21(28-3)22(14-17)29-4/h8-11,14,16H,5-7,12-13,15H2,1-4H3.
What are the key properties of 3-[5-chloro-2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N,N-diethylpropan-1-amine?
3-[5-chloro-2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N,N-diethylpropan-1-amine has a molecular weight of 415.97 g/mol, XLogP of 5.03, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-chloro-2-[(3,4-dimethoxyphenyl)methyl]benzimidazol-1-yl]-N,N-diethylpropan-1-amine is sourced from PubChem (CID 46308855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).