C18H27N3O2 — CID 46309354
2-butan-2-yl-1-[2-(diethylamino)ethyl]benzimidazole-5-carboxylic acid (PubChem CID 46309354) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 2-butan-2-yl-1-[2-(diethylamino)ethyl]benzimidazole-5-carboxylic acid.
| Compound Name | 2-butan-2-yl-1-[2-(diethylamino)ethyl]benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 46309354 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 2-butan-2-yl-1-[2-(diethylamino)ethyl]benzimidazole-5-carboxylic acid |
| SMILES | CCC(C)c1nc2cc(C(=O)O)ccc2n1CCN(CC)CC |
| InChI | InChI=1S/C18H27N3O2/c1-5-13(4)17-19-15-12-14(18(22)23)8-9-16(15)21(17)11-10-20(6-2)7-3/h8-9,12-13H,5-7,10-11H2,1-4H3,(H,22,23) |
| InChIKey | AXVJYKWHGIVLKA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |