About 2-(5-chloro-2-thiophen-2-ylbenzimidazol-1-yl)-N,N-diethylethanamine
2-(5-chloro-2-thiophen-2-ylbenzimidazol-1-yl)-N,N-diethylethanamine (PubChem CID 46309439) has the molecular formula C17H20ClN3S
and a molecular weight of 333.89 g/mol. Its IUPAC name is 2-(5-chloro-2-thiophen-2-ylbenzimidazol-1-yl)-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-(5-chloro-2-thiophen-2-ylbenzimidazol-1-yl)-N,N-diethylethanamine |
| PubChem CID | 46309439 |
| Molecular Formula | C17H20ClN3S |
| Molecular Weight | 333.89 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 2-(5-chloro-2-thiophen-2-ylbenzimidazol-1-yl)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCn1c(-c2cccs2)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C17H20ClN3S/c1-3-20(4-2)9-10-21-15-8-7-13(18)12-14(15)19-17(21)16-6-5-11-22-16/h5-8,11-12H,3-4,9-10H2,1-2H3 |
| InChIKey | NXZGOMAQFZBFSZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.89 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-chloro-2-thiophen-2-ylbenzimidazol-1-yl)-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-2-thiophen-2-ylbenzimidazol-1-yl)-N,N-diethylethanamine?
The IUPAC name of 2-(5-chloro-2-thiophen-2-ylbenzimidazol-1-yl)-N,N-diethylethanamine (CID 46309439) is 2-(5-chloro-2-thiophen-2-ylbenzimidazol-1-yl)-N,N-diethylethanamine.
What is the SMILES notation for 2-(5-chloro-2-thiophen-2-ylbenzimidazol-1-yl)-N,N-diethylethanamine?
The canonical SMILES for 2-(5-chloro-2-thiophen-2-ylbenzimidazol-1-yl)-N,N-diethylethanamine is CCN(CC)CCn1c(-c2cccs2)nc2cc(Cl)ccc21.
What is the InChIKey of 2-(5-chloro-2-thiophen-2-ylbenzimidazol-1-yl)-N,N-diethylethanamine?
The InChIKey is NXZGOMAQFZBFSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClN3S/c1-3-20(4-2)9-10-21-15-8-7-13(18)12-14(15)19-17(21)16-6-5-11-22-16/h5-8,11-12H,3-4,9-10H2,1-2H3.
What are the key properties of 2-(5-chloro-2-thiophen-2-ylbenzimidazol-1-yl)-N,N-diethylethanamine?
2-(5-chloro-2-thiophen-2-ylbenzimidazol-1-yl)-N,N-diethylethanamine has a molecular weight of 333.89 g/mol, XLogP of 4.76, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-2-thiophen-2-ylbenzimidazol-1-yl)-N,N-diethylethanamine is sourced from PubChem (CID 46309439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).