C17H17ClN2O — CID 46310370
6-chloro-2-[(2,4-dimethylphenoxy)methyl]-1-methylbenzimidazole (PubChem CID 46310370) has the molecular formula C17H17ClN2O and a molecular weight of 300.79 g/mol. Its IUPAC name is 6-chloro-2-[(2,4-dimethylphenoxy)methyl]-1-methylbenzimidazole.
| Compound Name | 6-chloro-2-[(2,4-dimethylphenoxy)methyl]-1-methylbenzimidazole |
|---|---|
| PubChem CID | 46310370 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 6-chloro-2-[(2,4-dimethylphenoxy)methyl]-1-methylbenzimidazole |
| SMILES | Cc1ccc(OCc2nc3ccc(Cl)cc3n2C)c(C)c1 |
| InChI | InChI=1S/C17H17ClN2O/c1-11-4-7-16(12(2)8-11)21-10-17-19-14-6-5-13(18)9-15(14)20(17)3/h4-9H,10H2,1-3H3 |
| InChIKey | KREOOZKFULCSBP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |