methyl 5-chloro-3-fluoropyridine-2-carboxylate

C7H5ClFNO2 — CID 46311239

IUPACmethyl 5-chloro-3-fluoropyridine-2-carboxylate
SMILESCOC(=O)c1ncc(Cl)cc1F
InChIInChI=1S/C7H5ClFNO2/c1-12-7(11)6-5(9)2-4(8)3-10-6/h2-3H,1H3
InChIKeyCSCZOWZTTGYYRE-UHFFFAOYSA-N
MW189.57 g/mol
LogP1.66
Rot. Bonds1

About methyl 5-chloro-3-fluoropyridine-2-carboxylate

methyl 5-chloro-3-fluoropyridine-2-carboxylate (PubChem CID 46311239) has the molecular formula C7H5ClFNO2 and a molecular weight of 189.57 g/mol. Its IUPAC name is methyl 5-chloro-3-fluoropyridine-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-chloro-3-fluoropyridine-2-carboxylate
PubChem CID46311239
Molecular FormulaC7H5ClFNO2
Molecular Weight189.57 g/mol
Exact Mass189.00
IUPAC Namemethyl 5-chloro-3-fluoropyridine-2-carboxylate
SMILESCOC(=O)c1ncc(Cl)cc1F
InChIInChI=1S/C7H5ClFNO2/c1-12-7(11)6-5(9)2-4(8)3-10-6/h2-3H,1H3
InChIKeyCSCZOWZTTGYYRE-UHFFFAOYSA-N
XLogP1.66
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.57
LogP ≤ 51.66
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 5-chloro-3-fluoropyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-chloro-3-fluoropyridine-2-carboxylate?
The IUPAC name of methyl 5-chloro-3-fluoropyridine-2-carboxylate (CID 46311239) is methyl 5-chloro-3-fluoropyridine-2-carboxylate.
What is the SMILES notation for methyl 5-chloro-3-fluoropyridine-2-carboxylate?
The canonical SMILES for methyl 5-chloro-3-fluoropyridine-2-carboxylate is COC(=O)c1ncc(Cl)cc1F.
What is the InChIKey of methyl 5-chloro-3-fluoropyridine-2-carboxylate?
The InChIKey is CSCZOWZTTGYYRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClFNO2/c1-12-7(11)6-5(9)2-4(8)3-10-6/h2-3H,1H3.
What are the key properties of methyl 5-chloro-3-fluoropyridine-2-carboxylate?
methyl 5-chloro-3-fluoropyridine-2-carboxylate has a molecular weight of 189.57 g/mol, XLogP of 1.66, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-chloro-3-fluoropyridine-2-carboxylate is sourced from PubChem (CID 46311239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).