C17H21N4O12PS — CID 4631218
7,8-dimethyl-2,4-dioxo-10-(2,3,4-trihydroxy-5-phosphonooxypentyl)benzo[g]pteridin-5-ium-5-sulfonate (PubChem CID 4631218) has the molecular formula C17H21N4O12PS and a molecular weight of 536.41 g/mol. Its IUPAC name is 7,8-dimethyl-2,4-dioxo-10-(2,3,4-trihydroxy-5-phosphonooxypentyl)benzo[g]pteridin-5-ium-5-sulfonate.
| Compound Name | 7,8-dimethyl-2,4-dioxo-10-(2,3,4-trihydroxy-5-phosphonooxypentyl)benzo[g]pteridin-5-ium-5-sulfonate |
|---|---|
| PubChem CID | 4631218 |
| Molecular Formula | C17H21N4O12PS |
| Molecular Weight | 536.41 g/mol |
| Exact Mass | 536.06 |
| IUPAC Name | 7,8-dimethyl-2,4-dioxo-10-(2,3,4-trihydroxy-5-phosphonooxypentyl)benzo[g]pteridin-5-ium-5-sulfonate |
| SMILES | Cc1cc2c(cc1C)[n+](S(=O)(=O)[O-])c1c(=O)[nH]c(=O)nc-1n2CC(O)C(O)C(O)COP(=O)(O)O |
| InChI | InChI=1S/C17H21N4O12PS/c1-7-3-9-10(4-8(7)2)21(35(30,31)32)13-15(18-17(26)19-16(13)25)20(9)5-11(22)14(24)12(23)6-33-34(27,28)29/h3-4,11-12,14,22-24H,5-6H2,1-2H3,(H3-,19,25,26,27,28,29,30,31,32) |
| InChIKey | ZLPUGFBBLGQWBS-UHFFFAOYSA-N |
| XLogP | -3.41 |
| TPSA | 256.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.41 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|