2-(3-fluoro-2-pyridin-3-ylphenyl)acetic acid

C13H10FNO2 — CID 46315774

IUPAC2-(3-fluoro-2-pyridin-3-ylphenyl)acetic acid
SMILESO=C(O)Cc1cccc(F)c1-c1cccnc1
InChIInChI=1S/C13H10FNO2/c14-11-5-1-3-9(7-12(16)17)13(11)10-4-2-6-15-8-10/h1-6,8H,7H2,(H,16,17)
InChIKeyRTAKXOGEGGQJOM-UHFFFAOYSA-N
MW231.23 g/mol
LogP2.51
Rot. Bonds3

About 2-(3-fluoro-2-pyridin-3-ylphenyl)acetic acid

2-(3-fluoro-2-pyridin-3-ylphenyl)acetic acid (PubChem CID 46315774) has the molecular formula C13H10FNO2 and a molecular weight of 231.23 g/mol. Its IUPAC name is 2-(3-fluoro-2-pyridin-3-ylphenyl)acetic acid.

Molecular Properties

Compound Name2-(3-fluoro-2-pyridin-3-ylphenyl)acetic acid
PubChem CID46315774
Molecular FormulaC13H10FNO2
Molecular Weight231.23 g/mol
Exact Mass231.07
IUPAC Name2-(3-fluoro-2-pyridin-3-ylphenyl)acetic acid
SMILESO=C(O)Cc1cccc(F)c1-c1cccnc1
InChIInChI=1S/C13H10FNO2/c14-11-5-1-3-9(7-12(16)17)13(11)10-4-2-6-15-8-10/h1-6,8H,7H2,(H,16,17)
InChIKeyRTAKXOGEGGQJOM-UHFFFAOYSA-N
XLogP2.51
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.23
LogP ≤ 52.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(3-fluoro-2-pyridin-3-ylphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(3-fluoro-2-phenylphenyl)acetic acid
CID 46314797
2-(5-fluoro-2-pyridin-3-yl-4-pyridinyl)acetic acid
CID 131869932
2-(2-fluoro-5-pyridin-3-ylphenyl)acetic acid
CID 46315790
2-(3-fluoro-2-pyridin-3-ylphenyl)-2-hydroxyacetic acid
CID 46315689
2-(5-fluoro-6-pyridin-3-yl-3-pyridinyl)acetic acid
CID 131869928
2-(5-fluoro-6-pyridin-3-yl-2-pyridinyl)acetic acid
CID 131870101
2-fluoro-6-pyridin-3-ylbenzoic acid
CID 46315544
2-(6-pyridin-3-yl-2-pyridinyl)acetic acid
CID 46316923
3-methyl-2-pyridin-3-ylbenzoic acid
CID 46317094
2-(6-methyl-3-pyridin-3-yl-2-pyridinyl)acetic acid
CID 46316907
(2-fluoro-6-pyridin-3-ylphenyl)methanol
CID 46315600
2-(2-chloro-5-pyridin-3-ylphenyl)acetic acid
CID 166638918

Frequently Asked Questions

What is the IUPAC name of 2-(3-fluoro-2-pyridin-3-ylphenyl)acetic acid?
The IUPAC name of 2-(3-fluoro-2-pyridin-3-ylphenyl)acetic acid (CID 46315774) is 2-(3-fluoro-2-pyridin-3-ylphenyl)acetic acid.
What is the SMILES notation for 2-(3-fluoro-2-pyridin-3-ylphenyl)acetic acid?
The canonical SMILES for 2-(3-fluoro-2-pyridin-3-ylphenyl)acetic acid is O=C(O)Cc1cccc(F)c1-c1cccnc1.
What is the InChIKey of 2-(3-fluoro-2-pyridin-3-ylphenyl)acetic acid?
The InChIKey is RTAKXOGEGGQJOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10FNO2/c14-11-5-1-3-9(7-12(16)17)13(11)10-4-2-6-15-8-10/h1-6,8H,7H2,(H,16,17).
What are the key properties of 2-(3-fluoro-2-pyridin-3-ylphenyl)acetic acid?
2-(3-fluoro-2-pyridin-3-ylphenyl)acetic acid has a molecular weight of 231.23 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluoro-2-pyridin-3-ylphenyl)acetic acid is sourced from PubChem (CID 46315774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).