C14H23N5O5 — CID 4631612
3-acetamido-4-(diaminomethylideneamino)-2-[methyl(propyl)carbamoyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 4631612) has the molecular formula C14H23N5O5 and a molecular weight of 341.37 g/mol. Its IUPAC name is 3-acetamido-4-(diaminomethylideneamino)-2-[methyl(propyl)carbamoyl]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | 3-acetamido-4-(diaminomethylideneamino)-2-[methyl(propyl)carbamoyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 4631612 |
| Molecular Formula | C14H23N5O5 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 3-acetamido-4-(diaminomethylideneamino)-2-[methyl(propyl)carbamoyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CCCN(C)C(=O)C1OC(C(=O)O)=CC(N=C(N)N)C1NC(C)=O |
| InChI | InChI=1S/C14H23N5O5/c1-4-5-19(3)12(21)11-10(17-7(2)20)8(18-14(15)16)6-9(24-11)13(22)23/h6,8,10-11H,4-5H2,1-3H3,(H,17,20)(H,22,23)(H4,15,16,18) |
| InChIKey | QPJWMZVTNXFTKV-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 160.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|