About 4-chloro-3,5-dipyridin-4-ylpyridine
4-chloro-3,5-dipyridin-4-ylpyridine (PubChem CID 46316335) has the molecular formula C15H10ClN3
and a molecular weight of 267.72 g/mol. Its IUPAC name is 4-chloro-3,5-dipyridin-4-ylpyridine.
Molecular Properties
| Compound Name | 4-chloro-3,5-dipyridin-4-ylpyridine |
| PubChem CID | 46316335 |
| Molecular Formula | C15H10ClN3 |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 4-chloro-3,5-dipyridin-4-ylpyridine |
| SMILES | Clc1c(-c2ccncc2)cncc1-c1ccncc1 |
| InChI | InChI=1S/C15H10ClN3/c16-15-13(11-1-5-17-6-2-11)9-19-10-14(15)12-3-7-18-8-4-12/h1-10H |
| InChIKey | CGNWFGOVGYAKDY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-3,5-dipyridin-4-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3,5-dipyridin-4-ylpyridine?
The IUPAC name of 4-chloro-3,5-dipyridin-4-ylpyridine (CID 46316335) is 4-chloro-3,5-dipyridin-4-ylpyridine.
What is the SMILES notation for 4-chloro-3,5-dipyridin-4-ylpyridine?
The canonical SMILES for 4-chloro-3,5-dipyridin-4-ylpyridine is Clc1c(-c2ccncc2)cncc1-c1ccncc1.
What is the InChIKey of 4-chloro-3,5-dipyridin-4-ylpyridine?
The InChIKey is CGNWFGOVGYAKDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClN3/c16-15-13(11-1-5-17-6-2-11)9-19-10-14(15)12-3-7-18-8-4-12/h1-10H.
What are the key properties of 4-chloro-3,5-dipyridin-4-ylpyridine?
4-chloro-3,5-dipyridin-4-ylpyridine has a molecular weight of 267.72 g/mol, XLogP of 3.86, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3,5-dipyridin-4-ylpyridine is sourced from PubChem (CID 46316335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).