C18H15N3O2 — CID 46317820
ethyl 3,6-dipyridin-4-ylpyridine-2-carboxylate (PubChem CID 46317820) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is ethyl 3,6-dipyridin-4-ylpyridine-2-carboxylate.
| Compound Name | ethyl 3,6-dipyridin-4-ylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 46317820 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | ethyl 3,6-dipyridin-4-ylpyridine-2-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccncc2)ccc1-c1ccncc1 |
| InChI | InChI=1S/C18H15N3O2/c1-2-23-18(22)17-15(13-5-9-19-10-6-13)3-4-16(21-17)14-7-11-20-12-8-14/h3-12H,2H2,1H3 |
| InChIKey | CRTRXYIKXZJTRP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |