C13H15FN2O2 — CID 46318141
methyl (E)-3-(2-fluoro-6-pyrrolidin-1-yl-3-pyridinyl)prop-2-enoate (PubChem CID 46318141) has the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. Its IUPAC name is methyl (E)-3-(2-fluoro-6-pyrrolidin-1-yl-3-pyridinyl)prop-2-enoate.
| Compound Name | methyl (E)-3-(2-fluoro-6-pyrrolidin-1-yl-3-pyridinyl)prop-2-enoate |
|---|---|
| PubChem CID | 46318141 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | methyl (E)-3-(2-fluoro-6-pyrrolidin-1-yl-3-pyridinyl)prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(N2CCCC2)nc1F |
| InChI | InChI=1S/C13H15FN2O2/c1-18-12(17)7-5-10-4-6-11(15-13(10)14)16-8-2-3-9-16/h4-7H,2-3,8-9H2,1H3/b7-5+ |
| InChIKey | DCFDZVSTNYXNCD-FNORWQNLSA-N |
| XLogP | 2.01 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|