C13H16BFN2O2 — CID 46318180
5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 46318180) has the molecular formula C13H16BFN2O2 and a molecular weight of 262.09 g/mol. Its IUPAC name is 5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 46318180 |
| Molecular Formula | C13H16BFN2O2 |
| Molecular Weight | 262.09 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 5-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CC1(C)OB(c2c[nH]c3ncc(F)cc23)OC1(C)C |
| InChI | InChI=1S/C13H16BFN2O2/c1-12(2)13(3,4)19-14(18-12)10-7-17-11-9(10)5-8(15)6-16-11/h5-7H,1-4H3,(H,16,17) |
| InChIKey | ZFZRLWYWYCQAHD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.09 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|