About 4-bromobutanimidamide;hydrochloride
4-bromobutanimidamide;hydrochloride (PubChem CID 46318427) has the molecular formula C4H10BrClN2
and a molecular weight of 201.49 g/mol. Its IUPAC name is 4-bromobutanimidamide;hydrochloride.
Molecular Properties
| Compound Name | 4-bromobutanimidamide;hydrochloride |
| PubChem CID | 46318427 |
| Molecular Formula | C4H10BrClN2 |
| Molecular Weight | 201.49 g/mol |
| Exact Mass | 199.97 |
| IUPAC Name | 4-bromobutanimidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(/N)CCCBr |
| InChI | InChI=1S/C4H9BrN2.ClH/c5-3-1-2-4(6)7;/h1-3H2,(H3,6,7);1H |
| InChIKey | NPJVUFGORTZITM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.49 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-bromobutanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromobutanimidamide;hydrochloride?
The IUPAC name of 4-bromobutanimidamide;hydrochloride (CID 46318427) is 4-bromobutanimidamide;hydrochloride.
What is the SMILES notation for 4-bromobutanimidamide;hydrochloride?
The canonical SMILES for 4-bromobutanimidamide;hydrochloride is Cl.[H]/N=C(/N)CCCBr.
What is the InChIKey of 4-bromobutanimidamide;hydrochloride?
The InChIKey is NPJVUFGORTZITM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9BrN2.ClH/c5-3-1-2-4(6)7;/h1-3H2,(H3,6,7);1H.
What are the key properties of 4-bromobutanimidamide;hydrochloride?
4-bromobutanimidamide;hydrochloride has a molecular weight of 201.49 g/mol, XLogP of 1.52, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromobutanimidamide;hydrochloride is sourced from PubChem (CID 46318427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).