C31H27ClN2O5S — CID 4631858
4-[(4-chlorophenyl)-hydroxymethylidene]-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(3-ethoxy-4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 4631858) has the molecular formula C31H27ClN2O5S and a molecular weight of 575.09 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)-hydroxymethylidene]-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(3-ethoxy-4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[(4-chlorophenyl)-hydroxymethylidene]-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(3-ethoxy-4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4631858 |
| Molecular Formula | C31H27ClN2O5S |
| Molecular Weight | 575.09 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | 4-[(4-chlorophenyl)-hydroxymethylidene]-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(3-ethoxy-4-prop-2-enoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | C=CCOc1ccc(C2C(=C(O)c3ccc(Cl)cc3)C(=O)C(=O)N2c2nc3c(C)cc(C)cc3s2)cc1OCC |
| InChI | InChI=1S/C31H27ClN2O5S/c1-5-13-39-22-12-9-20(16-23(22)38-6-2)27-25(28(35)19-7-10-21(32)11-8-19)29(36)30(37)34(27)31-33-26-18(4)14-17(3)15-24(26)40-31/h5,7-12,14-16,27,35H,1,6,13H2,2-4H3 |
| InChIKey | RKMQWXRBISPQOG-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.09 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|