C26H24N2O4 — CID 46318881
4-ethoxy-N,2-bis(3-methoxyphenyl)quinoline-6-carboxamide (PubChem CID 46318881) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is 4-ethoxy-N,2-bis(3-methoxyphenyl)quinoline-6-carboxamide.
| Compound Name | 4-ethoxy-N,2-bis(3-methoxyphenyl)quinoline-6-carboxamide |
|---|---|
| PubChem CID | 46318881 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 4-ethoxy-N,2-bis(3-methoxyphenyl)quinoline-6-carboxamide |
| SMILES | CCOc1cc(-c2cccc(OC)c2)nc2ccc(C(=O)Nc3cccc(OC)c3)cc12 |
| InChI | InChI=1S/C26H24N2O4/c1-4-32-25-16-24(17-7-5-9-20(13-17)30-2)28-23-12-11-18(14-22(23)25)26(29)27-19-8-6-10-21(15-19)31-3/h5-16H,4H2,1-3H3,(H,27,29) |
| InChIKey | AYTHOFPOSHHPSQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |