C25H28FN5O — CID 46323923
[1-(4-fluorophenyl)-5-pyridin-3-ylpyrazol-3-yl]-(4-piperidin-1-ylpiperidin-1-yl)methanone (PubChem CID 46323923) has the molecular formula C25H28FN5O and a molecular weight of 433.53 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-5-pyridin-3-ylpyrazol-3-yl]-(4-piperidin-1-ylpiperidin-1-yl)methanone.
| Compound Name | [1-(4-fluorophenyl)-5-pyridin-3-ylpyrazol-3-yl]-(4-piperidin-1-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 46323923 |
| Molecular Formula | C25H28FN5O |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | [1-(4-fluorophenyl)-5-pyridin-3-ylpyrazol-3-yl]-(4-piperidin-1-ylpiperidin-1-yl)methanone |
| SMILES | O=C(c1cc(-c2cccnc2)n(-c2ccc(F)cc2)n1)N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C25H28FN5O/c26-20-6-8-22(9-7-20)31-24(19-5-4-12-27-18-19)17-23(28-31)25(32)30-15-10-21(11-16-30)29-13-2-1-3-14-29/h4-9,12,17-18,21H,1-3,10-11,13-16H2 |
| InChIKey | SYFFRZNWOLBQJX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |