C18H14N2O2 — CID 46329150
2-(3,4-dimethylphenyl)chromeno[2,3-c]pyrazol-3-one (PubChem CID 46329150) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)chromeno[2,3-c]pyrazol-3-one.
| Compound Name | 2-(3,4-dimethylphenyl)chromeno[2,3-c]pyrazol-3-one |
|---|---|
| PubChem CID | 46329150 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-(3,4-dimethylphenyl)chromeno[2,3-c]pyrazol-3-one |
| SMILES | Cc1ccc(-n2nc3oc4ccccc4cc-3c2=O)cc1C |
| InChI | InChI=1S/C18H14N2O2/c1-11-7-8-14(9-12(11)2)20-18(21)15-10-13-5-3-4-6-16(13)22-17(15)19-20/h3-10H,1-2H3 |
| InChIKey | OBDBTZYCHVBBJB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |