C18H14N2O3 — CID 46329182
2-(2,4-dimethylphenyl)-1H-chromeno[2,3-c]pyrazole-3,7-dione (PubChem CID 46329182) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-1H-chromeno[2,3-c]pyrazole-3,7-dione.
| Compound Name | 2-(2,4-dimethylphenyl)-1H-chromeno[2,3-c]pyrazole-3,7-dione |
|---|---|
| PubChem CID | 46329182 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-1H-chromeno[2,3-c]pyrazole-3,7-dione |
| SMILES | Cc1ccc(-n2[nH]c3oc4cc(=O)ccc-4cc3c2=O)c(C)c1 |
| InChI | InChI=1S/C18H14N2O3/c1-10-3-6-15(11(2)7-10)20-18(22)14-8-12-4-5-13(21)9-16(12)23-17(14)19-20/h3-9,19H,1-2H3 |
| InChIKey | AFWNLGXGHDOTCR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |