About 3-hydrazinylidene-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate
3-hydrazinylidene-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 4632949) has the molecular formula C11H17N2O2-
and a molecular weight of 209.27 g/mol. Its IUPAC name is 3-hydrazinylidene-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate.
Molecular Properties
| Compound Name | 3-hydrazinylidene-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate |
| PubChem CID | 4632949 |
| Molecular Formula | C11H17N2O2- |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 3-hydrazinylidene-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC12CCC(C(=O)[O-])(CC1=NN)C2(C)C |
| InChI | InChI=1S/C11H18N2O2/c1-9(2)10(3)4-5-11(9,8(14)15)6-7(10)13-12/h4-6,12H2,1-3H3,(H,14,15)/p-1 |
| InChIKey | RHFYQGSVOPZKPI-UHFFFAOYSA-M |
| XLogP | 0.27 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hydrazinylidene-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydrazinylidene-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate?
The IUPAC name of 3-hydrazinylidene-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate (CID 4632949) is 3-hydrazinylidene-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate.
What is the SMILES notation for 3-hydrazinylidene-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate?
The canonical SMILES for 3-hydrazinylidene-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate is CC12CCC(C(=O)[O-])(CC1=NN)C2(C)C.
What is the InChIKey of 3-hydrazinylidene-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate?
The InChIKey is RHFYQGSVOPZKPI-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H18N2O2/c1-9(2)10(3)4-5-11(9,8(14)15)6-7(10)13-12/h4-6,12H2,1-3H3,(H,14,15)/p-1.
What are the key properties of 3-hydrazinylidene-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate?
3-hydrazinylidene-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate has a molecular weight of 209.27 g/mol, XLogP of 0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydrazinylidene-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate is sourced from PubChem (CID 4632949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).