About N-butan-2-yl-2-[1-(3,5-dimethyl-1H-pyrrole-2-carbonyl)piperidin-4-yl]acetamide
N-butan-2-yl-2-[1-(3,5-dimethyl-1H-pyrrole-2-carbonyl)piperidin-4-yl]acetamide (PubChem CID 46330382) has the molecular formula C18H29N3O2
and a molecular weight of 319.45 g/mol. Its IUPAC name is N-butan-2-yl-2-[1-(3,5-dimethyl-1H-pyrrole-2-carbonyl)piperidin-4-yl]acetamide.
Molecular Properties
| Compound Name | N-butan-2-yl-2-[1-(3,5-dimethyl-1H-pyrrole-2-carbonyl)piperidin-4-yl]acetamide |
| PubChem CID | 46330382 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | N-butan-2-yl-2-[1-(3,5-dimethyl-1H-pyrrole-2-carbonyl)piperidin-4-yl]acetamide |
| SMILES | CCC(C)NC(=O)CC1CCN(C(=O)c2[nH]c(C)cc2C)CC1 |
| InChI | InChI=1S/C18H29N3O2/c1-5-13(3)19-16(22)11-15-6-8-21(9-7-15)18(23)17-12(2)10-14(4)20-17/h10,13,15,20H,5-9,11H2,1-4H3,(H,19,22) |
| InChIKey | WUOBCOSMIIZJOT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-butan-2-yl-2-[1-(3,5-dimethyl-1H-pyrrole-2-carbonyl)piperidin-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-2-[1-(3,5-dimethyl-1H-pyrrole-2-carbonyl)piperidin-4-yl]acetamide?
The IUPAC name of N-butan-2-yl-2-[1-(3,5-dimethyl-1H-pyrrole-2-carbonyl)piperidin-4-yl]acetamide (CID 46330382) is N-butan-2-yl-2-[1-(3,5-dimethyl-1H-pyrrole-2-carbonyl)piperidin-4-yl]acetamide.
What is the SMILES notation for N-butan-2-yl-2-[1-(3,5-dimethyl-1H-pyrrole-2-carbonyl)piperidin-4-yl]acetamide?
The canonical SMILES for N-butan-2-yl-2-[1-(3,5-dimethyl-1H-pyrrole-2-carbonyl)piperidin-4-yl]acetamide is CCC(C)NC(=O)CC1CCN(C(=O)c2[nH]c(C)cc2C)CC1.
What is the InChIKey of N-butan-2-yl-2-[1-(3,5-dimethyl-1H-pyrrole-2-carbonyl)piperidin-4-yl]acetamide?
The InChIKey is WUOBCOSMIIZJOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N3O2/c1-5-13(3)19-16(22)11-15-6-8-21(9-7-15)18(23)17-12(2)10-14(4)20-17/h10,13,15,20H,5-9,11H2,1-4H3,(H,19,22).
What are the key properties of N-butan-2-yl-2-[1-(3,5-dimethyl-1H-pyrrole-2-carbonyl)piperidin-4-yl]acetamide?
N-butan-2-yl-2-[1-(3,5-dimethyl-1H-pyrrole-2-carbonyl)piperidin-4-yl]acetamide has a molecular weight of 319.45 g/mol, XLogP of 2.79, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-2-[1-(3,5-dimethyl-1H-pyrrole-2-carbonyl)piperidin-4-yl]acetamide is sourced from PubChem (CID 46330382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).