C24H18F2N4O — CID 46331192
N-[(4-fluorophenyl)methyl]-3-[[2-(4-fluorophenyl)pyrimidin-4-yl]amino]benzamide (PubChem CID 46331192) has the molecular formula C24H18F2N4O and a molecular weight of 416.43 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-[[2-(4-fluorophenyl)pyrimidin-4-yl]amino]benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-[[2-(4-fluorophenyl)pyrimidin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 46331192 |
| Molecular Formula | C24H18F2N4O |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-[[2-(4-fluorophenyl)pyrimidin-4-yl]amino]benzamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1cccc(Nc2ccnc(-c3ccc(F)cc3)n2)c1 |
| InChI | InChI=1S/C24H18F2N4O/c25-19-8-4-16(5-9-19)15-28-24(31)18-2-1-3-21(14-18)29-22-12-13-27-23(30-22)17-6-10-20(26)11-7-17/h1-14H,15H2,(H,28,31)(H,27,29,30) |
| InChIKey | VCOPYSDGQRJNFP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |