About 3-[3-[(3,5-difluorophenyl)methylcarbamoyl]phenyl]-N-ethylpiperidine-1-carboxamide
3-[3-[(3,5-difluorophenyl)methylcarbamoyl]phenyl]-N-ethylpiperidine-1-carboxamide (PubChem CID 46334232) has the molecular formula C22H25F2N3O2
and a molecular weight of 401.46 g/mol. Its IUPAC name is 3-[3-[(3,5-difluorophenyl)methylcarbamoyl]phenyl]-N-ethylpiperidine-1-carboxamide.
Molecular Properties
| Compound Name | 3-[3-[(3,5-difluorophenyl)methylcarbamoyl]phenyl]-N-ethylpiperidine-1-carboxamide |
| PubChem CID | 46334232 |
| Molecular Formula | C22H25F2N3O2 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 3-[3-[(3,5-difluorophenyl)methylcarbamoyl]phenyl]-N-ethylpiperidine-1-carboxamide |
| SMILES | CCNC(=O)N1CCCC(c2cccc(C(=O)NCc3cc(F)cc(F)c3)c2)C1 |
| InChI | InChI=1S/C22H25F2N3O2/c1-2-25-22(29)27-8-4-7-18(14-27)16-5-3-6-17(11-16)21(28)26-13-15-9-19(23)12-20(24)10-15/h3,5-6,9-12,18H,2,4,7-8,13-14H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | VDZLKIQTRIUKRB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[3-[(3,5-difluorophenyl)methylcarbamoyl]phenyl]-N-ethylpiperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[(3,5-difluorophenyl)methylcarbamoyl]phenyl]-N-ethylpiperidine-1-carboxamide?
The IUPAC name of 3-[3-[(3,5-difluorophenyl)methylcarbamoyl]phenyl]-N-ethylpiperidine-1-carboxamide (CID 46334232) is 3-[3-[(3,5-difluorophenyl)methylcarbamoyl]phenyl]-N-ethylpiperidine-1-carboxamide.
What is the SMILES notation for 3-[3-[(3,5-difluorophenyl)methylcarbamoyl]phenyl]-N-ethylpiperidine-1-carboxamide?
The canonical SMILES for 3-[3-[(3,5-difluorophenyl)methylcarbamoyl]phenyl]-N-ethylpiperidine-1-carboxamide is CCNC(=O)N1CCCC(c2cccc(C(=O)NCc3cc(F)cc(F)c3)c2)C1.
What is the InChIKey of 3-[3-[(3,5-difluorophenyl)methylcarbamoyl]phenyl]-N-ethylpiperidine-1-carboxamide?
The InChIKey is VDZLKIQTRIUKRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25F2N3O2/c1-2-25-22(29)27-8-4-7-18(14-27)16-5-3-6-17(11-16)21(28)26-13-15-9-19(23)12-20(24)10-15/h3,5-6,9-12,18H,2,4,7-8,13-14H2,1H3,(H,25,29)(H,26,28).
What are the key properties of 3-[3-[(3,5-difluorophenyl)methylcarbamoyl]phenyl]-N-ethylpiperidine-1-carboxamide?
3-[3-[(3,5-difluorophenyl)methylcarbamoyl]phenyl]-N-ethylpiperidine-1-carboxamide has a molecular weight of 401.46 g/mol, XLogP of 3.80, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[(3,5-difluorophenyl)methylcarbamoyl]phenyl]-N-ethylpiperidine-1-carboxamide is sourced from PubChem (CID 46334232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).