C25H43NO8S — CID 4633470
[4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]methyl hydrogen sulfate (PubChem CID 4633470) has the molecular formula C25H43NO8S and a molecular weight of 517.69 g/mol. Its IUPAC name is [4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]methyl hydrogen sulfate.
| Compound Name | [4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 4633470 |
| Molecular Formula | C25H43NO8S |
| Molecular Weight | 517.69 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | [4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]methyl hydrogen sulfate |
| SMILES | CC(CCC(=O)NCOS(=O)(=O)O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C |
| InChI | InChI=1S/C25H43NO8S/c1-14(4-7-22(30)26-13-34-35(31,32)33)17-5-6-18-23-19(12-21(29)25(17,18)3)24(2)9-8-16(27)10-15(24)11-20(23)28/h14-21,23,27-29H,4-13H2,1-3H3,(H,26,30)(H,31,32,33) |
| InChIKey | FWLBKXICBUMPIS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 153.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.69 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|