About 4-benzo[b][1,4]benzoxazepin-6-yl-N-(3,4-dimethylphenyl)piperazine-1-carboxamide
4-benzo[b][1,4]benzoxazepin-6-yl-N-(3,4-dimethylphenyl)piperazine-1-carboxamide (PubChem CID 46335361) has the molecular formula C26H26N4O2
and a molecular weight of 426.52 g/mol. Its IUPAC name is 4-benzo[b][1,4]benzoxazepin-6-yl-N-(3,4-dimethylphenyl)piperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-benzo[b][1,4]benzoxazepin-6-yl-N-(3,4-dimethylphenyl)piperazine-1-carboxamide |
| PubChem CID | 46335361 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 4-benzo[b][1,4]benzoxazepin-6-yl-N-(3,4-dimethylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCN(C3=Nc4ccccc4Oc4ccccc43)CC2)cc1C |
| InChI | InChI=1S/C26H26N4O2/c1-18-11-12-20(17-19(18)2)27-26(31)30-15-13-29(14-16-30)25-21-7-3-5-9-23(21)32-24-10-6-4-8-22(24)28-25/h3-12,17H,13-16H2,1-2H3,(H,27,31) |
| InChIKey | AIQJYLLZZBREON-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-benzo[b][1,4]benzoxazepin-6-yl-N-(3,4-dimethylphenyl)piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzo[b][1,4]benzoxazepin-6-yl-N-(3,4-dimethylphenyl)piperazine-1-carboxamide?
The IUPAC name of 4-benzo[b][1,4]benzoxazepin-6-yl-N-(3,4-dimethylphenyl)piperazine-1-carboxamide (CID 46335361) is 4-benzo[b][1,4]benzoxazepin-6-yl-N-(3,4-dimethylphenyl)piperazine-1-carboxamide.
What is the SMILES notation for 4-benzo[b][1,4]benzoxazepin-6-yl-N-(3,4-dimethylphenyl)piperazine-1-carboxamide?
The canonical SMILES for 4-benzo[b][1,4]benzoxazepin-6-yl-N-(3,4-dimethylphenyl)piperazine-1-carboxamide is Cc1ccc(NC(=O)N2CCN(C3=Nc4ccccc4Oc4ccccc43)CC2)cc1C.
What is the InChIKey of 4-benzo[b][1,4]benzoxazepin-6-yl-N-(3,4-dimethylphenyl)piperazine-1-carboxamide?
The InChIKey is AIQJYLLZZBREON-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26N4O2/c1-18-11-12-20(17-19(18)2)27-26(31)30-15-13-29(14-16-30)25-21-7-3-5-9-23(21)32-24-10-6-4-8-22(24)28-25/h3-12,17H,13-16H2,1-2H3,(H,27,31).
What are the key properties of 4-benzo[b][1,4]benzoxazepin-6-yl-N-(3,4-dimethylphenyl)piperazine-1-carboxamide?
4-benzo[b][1,4]benzoxazepin-6-yl-N-(3,4-dimethylphenyl)piperazine-1-carboxamide has a molecular weight of 426.52 g/mol, XLogP of 5.34, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzo[b][1,4]benzoxazepin-6-yl-N-(3,4-dimethylphenyl)piperazine-1-carboxamide is sourced from PubChem (CID 46335361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).