About N-(4-cyanophenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonamide
N-(4-cyanophenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonamide (PubChem CID 46335625) has the molecular formula C16H13N3O3S2
and a molecular weight of 359.43 g/mol. Its IUPAC name is N-(4-cyanophenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonamide.
Molecular Properties
| Compound Name | N-(4-cyanophenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonamide |
| PubChem CID | 46335625 |
| Molecular Formula | C16H13N3O3S2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | N-(4-cyanophenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonamide |
| SMILES | N#Cc1ccc(NS(=O)(=O)c2ccc3c(c2)NC(=O)CCS3)cc1 |
| InChI | InChI=1S/C16H13N3O3S2/c17-10-11-1-3-12(4-2-11)19-24(21,22)13-5-6-15-14(9-13)18-16(20)7-8-23-15/h1-6,9,19H,7-8H2,(H,18,20) |
| InChIKey | XGKNKZNEFLYDDS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-cyanophenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyanophenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonamide?
The IUPAC name of N-(4-cyanophenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonamide (CID 46335625) is N-(4-cyanophenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonamide.
What is the SMILES notation for N-(4-cyanophenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonamide?
The canonical SMILES for N-(4-cyanophenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonamide is N#Cc1ccc(NS(=O)(=O)c2ccc3c(c2)NC(=O)CCS3)cc1.
What is the InChIKey of N-(4-cyanophenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonamide?
The InChIKey is XGKNKZNEFLYDDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O3S2/c17-10-11-1-3-12(4-2-11)19-24(21,22)13-5-6-15-14(9-13)18-16(20)7-8-23-15/h1-6,9,19H,7-8H2,(H,18,20).
What are the key properties of N-(4-cyanophenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonamide?
N-(4-cyanophenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonamide has a molecular weight of 359.43 g/mol, XLogP of 2.79, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyanophenyl)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-7-sulfonamide is sourced from PubChem (CID 46335625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).