C18H14ClN5O3S — CID 46337919
N-[(4-chlorophenyl)methyl]-2-[[2-(furan-2-yl)-7-oxo-6H-pyrazolo[1,5-a][1,3,5]triazin-4-yl]sulfanyl]acetamide (PubChem CID 46337919) has the molecular formula C18H14ClN5O3S and a molecular weight of 415.86 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[[2-(furan-2-yl)-7-oxo-6H-pyrazolo[1,5-a][1,3,5]triazin-4-yl]sulfanyl]acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[[2-(furan-2-yl)-7-oxo-6H-pyrazolo[1,5-a][1,3,5]triazin-4-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 46337919 |
| Molecular Formula | C18H14ClN5O3S |
| Molecular Weight | 415.86 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[[2-(furan-2-yl)-7-oxo-6H-pyrazolo[1,5-a][1,3,5]triazin-4-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nc(-c2ccco2)nc2cc(=O)[nH]n12)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14ClN5O3S/c19-12-5-3-11(4-6-12)9-20-16(26)10-28-18-22-17(13-2-1-7-27-13)21-14-8-15(25)23-24(14)18/h1-8H,9-10H2,(H,20,26)(H,23,25) |
| InChIKey | KVVUORTVNGVKJG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.86 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_pyridine_A(1)', 'substructure': 'N/A'} |
|---|