C20H17N3 — CID 4633808
2-amino-5,6-dimethyl-4-(4-phenylphenyl)pyridine-3-carbonitrile (PubChem CID 4633808) has the molecular formula C20H17N3 and a molecular weight of 299.38 g/mol. Its IUPAC name is 2-amino-5,6-dimethyl-4-(4-phenylphenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-5,6-dimethyl-4-(4-phenylphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 4633808 |
| Molecular Formula | C20H17N3 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 2-amino-5,6-dimethyl-4-(4-phenylphenyl)pyridine-3-carbonitrile |
| SMILES | Cc1nc(N)c(C#N)c(-c2ccc(-c3ccccc3)cc2)c1C |
| InChI | InChI=1S/C20H17N3/c1-13-14(2)23-20(22)18(12-21)19(13)17-10-8-16(9-11-17)15-6-4-3-5-7-15/h3-11H,1-2H3,(H2,22,23) |
| InChIKey | HAWJYAGERKCBAN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |