C17H23N3O3 — CID 46339574
N-(3,4-dimethoxyphenyl)-3-(3,5-dimethylpyrazol-1-yl)butanamide (PubChem CID 46339574) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-3-(3,5-dimethylpyrazol-1-yl)butanamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-3-(3,5-dimethylpyrazol-1-yl)butanamide |
|---|---|
| PubChem CID | 46339574 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-3-(3,5-dimethylpyrazol-1-yl)butanamide |
| SMILES | COc1ccc(NC(=O)CC(C)n2nc(C)cc2C)cc1OC |
| InChI | InChI=1S/C17H23N3O3/c1-11-8-12(2)20(19-11)13(3)9-17(21)18-14-6-7-15(22-4)16(10-14)23-5/h6-8,10,13H,9H2,1-5H3,(H,18,21) |
| InChIKey | BQUUQTMMOJFBBK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |