About 1-ethyl-N,N-dimethyl-3-oxo-2,4-dihydroquinoxaline-6-sulfonamide
1-ethyl-N,N-dimethyl-3-oxo-2,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 46344065) has the molecular formula C12H17N3O3S
and a molecular weight of 283.35 g/mol. Its IUPAC name is 1-ethyl-N,N-dimethyl-3-oxo-2,4-dihydroquinoxaline-6-sulfonamide.
Molecular Properties
| Compound Name | 1-ethyl-N,N-dimethyl-3-oxo-2,4-dihydroquinoxaline-6-sulfonamide |
| PubChem CID | 46344065 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-ethyl-N,N-dimethyl-3-oxo-2,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | CCN1CC(=O)Nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C12H17N3O3S/c1-4-15-8-12(16)13-10-7-9(5-6-11(10)15)19(17,18)14(2)3/h5-7H,4,8H2,1-3H3,(H,13,16) |
| InChIKey | UQARRWUBNUGFSX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-N,N-dimethyl-3-oxo-2,4-dihydroquinoxaline-6-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-N,N-dimethyl-3-oxo-2,4-dihydroquinoxaline-6-sulfonamide?
The IUPAC name of 1-ethyl-N,N-dimethyl-3-oxo-2,4-dihydroquinoxaline-6-sulfonamide (CID 46344065) is 1-ethyl-N,N-dimethyl-3-oxo-2,4-dihydroquinoxaline-6-sulfonamide.
What is the SMILES notation for 1-ethyl-N,N-dimethyl-3-oxo-2,4-dihydroquinoxaline-6-sulfonamide?
The canonical SMILES for 1-ethyl-N,N-dimethyl-3-oxo-2,4-dihydroquinoxaline-6-sulfonamide is CCN1CC(=O)Nc2cc(S(=O)(=O)N(C)C)ccc21.
What is the InChIKey of 1-ethyl-N,N-dimethyl-3-oxo-2,4-dihydroquinoxaline-6-sulfonamide?
The InChIKey is UQARRWUBNUGFSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O3S/c1-4-15-8-12(16)13-10-7-9(5-6-11(10)15)19(17,18)14(2)3/h5-7H,4,8H2,1-3H3,(H,13,16).
What are the key properties of 1-ethyl-N,N-dimethyl-3-oxo-2,4-dihydroquinoxaline-6-sulfonamide?
1-ethyl-N,N-dimethyl-3-oxo-2,4-dihydroquinoxaline-6-sulfonamide has a molecular weight of 283.35 g/mol, XLogP of 0.72, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-N,N-dimethyl-3-oxo-2,4-dihydroquinoxaline-6-sulfonamide is sourced from PubChem (CID 46344065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).