C20H19F4N5OS — CID 46344878
4-(4-ethylpiperazin-1-yl)-5-methyl-N-(2,3,5,6-tetrafluorophenyl)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 46344878) has the molecular formula C20H19F4N5OS and a molecular weight of 453.47 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-1-yl)-5-methyl-N-(2,3,5,6-tetrafluorophenyl)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 4-(4-ethylpiperazin-1-yl)-5-methyl-N-(2,3,5,6-tetrafluorophenyl)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 46344878 |
| Molecular Formula | C20H19F4N5OS |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 4-(4-ethylpiperazin-1-yl)-5-methyl-N-(2,3,5,6-tetrafluorophenyl)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CCN1CCN(c2ncnc3sc(C(=O)Nc4c(F)c(F)cc(F)c4F)c(C)c23)CC1 |
| InChI | InChI=1S/C20H19F4N5OS/c1-3-28-4-6-29(7-5-28)18-13-10(2)17(31-20(13)26-9-25-18)19(30)27-16-14(23)11(21)8-12(22)15(16)24/h8-9H,3-7H2,1-2H3,(H,27,30) |
| InChIKey | GIBZXTAXGGMCBH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|