C21H31N5O4S — CID 46345195
N-[[4-(dimethylamino)phenyl]methyl]-3-(3,5-dimethyl-4-morpholin-4-ylsulfonylpyrazol-1-yl)propanamide (PubChem CID 46345195) has the molecular formula C21H31N5O4S and a molecular weight of 449.58 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-3-(3,5-dimethyl-4-morpholin-4-ylsulfonylpyrazol-1-yl)propanamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-3-(3,5-dimethyl-4-morpholin-4-ylsulfonylpyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 46345195 |
| Molecular Formula | C21H31N5O4S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-3-(3,5-dimethyl-4-morpholin-4-ylsulfonylpyrazol-1-yl)propanamide |
| SMILES | Cc1nn(CCC(=O)NCc2ccc(N(C)C)cc2)c(C)c1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H31N5O4S/c1-16-21(31(28,29)25-11-13-30-14-12-25)17(2)26(23-16)10-9-20(27)22-15-18-5-7-19(8-6-18)24(3)4/h5-8H,9-15H2,1-4H3,(H,22,27) |
| InChIKey | OXONADIKYHMIQI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|