C25H28ClN5O — CID 46346060
6-[(2-chlorophenyl)methyl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 46346060) has the molecular formula C25H28ClN5O and a molecular weight of 449.99 g/mol. Its IUPAC name is 6-[(2-chlorophenyl)methyl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 6-[(2-chlorophenyl)methyl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 46346060 |
| Molecular Formula | C25H28ClN5O |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 6-[(2-chlorophenyl)methyl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | COc1ccc(N2CCN(c3ncc4c(n3)CCN(Cc3ccccc3Cl)C4)CC2)cc1 |
| InChI | InChI=1S/C25H28ClN5O/c1-32-22-8-6-21(7-9-22)30-12-14-31(15-13-30)25-27-16-20-18-29(11-10-24(20)28-25)17-19-4-2-3-5-23(19)26/h2-9,16H,10-15,17-18H2,1H3 |
| InChIKey | HJSXSMLXROODTL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|