C27H25ClN4O2 — CID 46346805
6-chloro-1-[2-[4-(4-methylphenyl)piperazin-1-yl]-2-oxoethyl]-4-phenylquinazolin-2-one (PubChem CID 46346805) has the molecular formula C27H25ClN4O2 and a molecular weight of 472.98 g/mol. Its IUPAC name is 6-chloro-1-[2-[4-(4-methylphenyl)piperazin-1-yl]-2-oxoethyl]-4-phenylquinazolin-2-one.
| Compound Name | 6-chloro-1-[2-[4-(4-methylphenyl)piperazin-1-yl]-2-oxoethyl]-4-phenylquinazolin-2-one |
|---|---|
| PubChem CID | 46346805 |
| Molecular Formula | C27H25ClN4O2 |
| Molecular Weight | 472.98 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 6-chloro-1-[2-[4-(4-methylphenyl)piperazin-1-yl]-2-oxoethyl]-4-phenylquinazolin-2-one |
| SMILES | Cc1ccc(N2CCN(C(=O)Cn3c(=O)nc(-c4ccccc4)c4cc(Cl)ccc43)CC2)cc1 |
| InChI | InChI=1S/C27H25ClN4O2/c1-19-7-10-22(11-8-19)30-13-15-31(16-14-30)25(33)18-32-24-12-9-21(28)17-23(24)26(29-27(32)34)20-5-3-2-4-6-20/h2-12,17H,13-16,18H2,1H3 |
| InChIKey | XZPQFIRXQFEPJP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.98 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|