About N-benzyl-N,2,2-trimethylbutanamide
N-benzyl-N,2,2-trimethylbutanamide (PubChem CID 4634732) has the molecular formula C14H21NO
and a molecular weight of 219.33 g/mol. Its IUPAC name is N-benzyl-N,2,2-trimethylbutanamide.
Molecular Properties
| Compound Name | N-benzyl-N,2,2-trimethylbutanamide |
| PubChem CID | 4634732 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | N-benzyl-N,2,2-trimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C14H21NO/c1-5-14(2,3)13(16)15(4)11-12-9-7-6-8-10-12/h6-10H,5,11H2,1-4H3 |
| InChIKey | SVPOUEVAPNKQTN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzyl-N,2,2-trimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N,2,2-trimethylbutanamide?
The IUPAC name of N-benzyl-N,2,2-trimethylbutanamide (CID 4634732) is N-benzyl-N,2,2-trimethylbutanamide.
What is the SMILES notation for N-benzyl-N,2,2-trimethylbutanamide?
The canonical SMILES for N-benzyl-N,2,2-trimethylbutanamide is CCC(C)(C)C(=O)N(C)Cc1ccccc1.
What is the InChIKey of N-benzyl-N,2,2-trimethylbutanamide?
The InChIKey is SVPOUEVAPNKQTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO/c1-5-14(2,3)13(16)15(4)11-12-9-7-6-8-10-12/h6-10H,5,11H2,1-4H3.
What are the key properties of N-benzyl-N,2,2-trimethylbutanamide?
N-benzyl-N,2,2-trimethylbutanamide has a molecular weight of 219.33 g/mol, XLogP of 3.08, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N,2,2-trimethylbutanamide is sourced from PubChem (CID 4634732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).