C29H26FN5O2 — CID 46348064
5-ethyl-9-(4-fluorophenyl)-N-(furan-2-ylmethyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 46348064) has the molecular formula C29H26FN5O2 and a molecular weight of 495.56 g/mol. Its IUPAC name is 5-ethyl-9-(4-fluorophenyl)-N-(furan-2-ylmethyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | 5-ethyl-9-(4-fluorophenyl)-N-(furan-2-ylmethyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 46348064 |
| Molecular Formula | C29H26FN5O2 |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 5-ethyl-9-(4-fluorophenyl)-N-(furan-2-ylmethyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | CCc1nn(-c2ccccc2)c2c1CN(C(=O)NCc1ccco1)C(c1ccc(F)cc1)c1cccn1-2 |
| InChI | InChI=1S/C29H26FN5O2/c1-2-25-24-19-34(29(36)31-18-23-10-7-17-37-23)27(20-12-14-21(30)15-13-20)26-11-6-16-33(26)28(24)35(32-25)22-8-4-3-5-9-22/h3-17,27H,2,18-19H2,1H3,(H,31,36) |
| InChIKey | BVKAAZLIOIDZJH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |