C31H27F2N5O — CID 46348433
N-(2,4-difluorophenyl)-9-(4-ethylphenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 46348433) has the molecular formula C31H27F2N5O and a molecular weight of 523.59 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-9-(4-ethylphenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-9-(4-ethylphenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 46348433 |
| Molecular Formula | C31H27F2N5O |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | N-(2,4-difluorophenyl)-9-(4-ethylphenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | CCc1ccc(C2c3cccn3-c3c(c(C)nn3-c3ccccc3)CN2C(=O)Nc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C31H27F2N5O/c1-3-21-11-13-22(14-12-21)29-28-10-7-17-36(28)30-25(20(2)35-38(30)24-8-5-4-6-9-24)19-37(29)31(39)34-27-16-15-23(32)18-26(27)33/h4-18,29H,3,19H2,1-2H3,(H,34,39) |
| InChIKey | CICYCDQGYBEVOU-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |