C33H33N5O2 — CID 46348710
N-(3,5-dimethylphenyl)-9-(3-ethoxyphenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 46348710) has the molecular formula C33H33N5O2 and a molecular weight of 531.66 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-9-(3-ethoxyphenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | N-(3,5-dimethylphenyl)-9-(3-ethoxyphenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 46348710 |
| Molecular Formula | C33H33N5O2 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | N-(3,5-dimethylphenyl)-9-(3-ethoxyphenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | CCOc1cccc(C2c3cccn3-c3c(c(C)nn3-c3ccccc3)CN2C(=O)Nc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C33H33N5O2/c1-5-40-28-14-9-11-25(20-28)31-30-15-10-16-36(30)32-29(24(4)35-38(32)27-12-7-6-8-13-27)21-37(31)33(39)34-26-18-22(2)17-23(3)19-26/h6-20,31H,5,21H2,1-4H3,(H,34,39) |
| InChIKey | SORDTRFDCBCRPY-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |