C13H18N4O4 — CID 46350102
2-(3,6-dimethyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)-N-(3-methoxypropyl)acetamide (PubChem CID 46350102) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-(3,6-dimethyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-(3,6-dimethyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 46350102 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2-(3,6-dimethyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)Cn1c(C)nc2onc(C)c2c1=O |
| InChI | InChI=1S/C13H18N4O4/c1-8-11-12(21-16-8)15-9(2)17(13(11)19)7-10(18)14-5-4-6-20-3/h4-7H2,1-3H3,(H,14,18) |
| InChIKey | WMHHFYCCGKXLLG-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|